Compound Q&A

What industries use 4-(3-Oxobutyl)phenyl beta-D-glucopyranoside (CAS: 38963-94-9)?

Answer

4-(3-Oxobutyl)phenyl beta-D-glucopyranoside
4-(3-Oxobutyl)phenyl beta-D-glucopyranoside is utilized in pharmaceutical research for its potential as a precursor in drug synthesis. It also finds applications in polymer science for the development of smart materials and in sensor technology for its ability to bind to specific molecules.

About

CAS No 38963-94-9
English Name 4-(3-Oxobutyl)phenyl beta-D-glucopyranoside
Molecular Formula C16H22O7
Molecular Weight 326.35 g/mol
SMILES CC(CCC1=CC=C(O[C@H]2[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O2)C=C1)=O
InChIKey IDONYWHRKBUDOR-IBEHDNSVSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(3-Oxobutyl)phenyl beta-D-glucopyranoside (CAS: 38963-94-9)?

4-(3-Oxobutyl)phenyl beta-D-glucopyranoside is a white crystalline powder with a molecular weight of...

Compound Q&A

How is 4-(3-Oxobutyl)phenyl beta-D-glucopyranoside (CAS: 38963-94-9) typically synthesized?

4-(3-Oxobutyl)phenyl beta-D-glucopyranoside is usually synthesized via a multistep process involving...

Compound Q&A

What precautions should be taken when handling 4-(3-Oxobutyl)phenyl beta-D-glucopyranoside (CAS: 38963-94-9)?

When handling 4-(3-Oxobutyl)phenyl beta-D-glucopyranoside, it is essential to wear appropriate prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...