Compound Q&A

What industries use 2-Methyl-2-propanyl L-tyrosinate (CAS: 16874-12-7)?

Answer

2-Methyl-2-propanyl L-tyrosinate
2-Methyl-2-propanyl L-tyrosinate finds application in the pharmaceutical industry for the synthesis of certain drug intermediates. It is also used in the production of certain polymers and as a component in sensors and semiconductors. Its unique properties make it suitable for various organic synthesis reactions and as a functional group in complex molecules.

About

CAS No 16874-12-7
English Name 2-Methyl-2-propanyl L-tyrosinate
Molecular Formula C13H19NO3
Molecular Weight 237.3 g/mol
SMILES CC(C)(C)OC(=O)C(CC1=CC=C(C=C1)O)N
InChIKey DIGHFXIWRPMGSA-NSHDSACASA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl L-tyrosinate (CAS: 16874-12-7)?

2-Methyl-2-propanyl L-tyrosinate is a crystalline compound with a molecular weight of approximately ...

Compound Q&A

How is 2-Methyl-2-propanyl L-tyrosinate (CAS: 16874-12-7) typically synthesized?

2-Methyl-2-propanyl L-tyrosinate is synthesized via a condensation reaction between 2-methyl-2-propa...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl L-tyrosinate (CAS: 16874-12-7)?

When handling 2-Methyl-2-propanyl L-tyrosinate, it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...