Compound Q&A

How is Alosetron HCl (CAS: 122852-69-1) typically synthesized?

Answer

Alosetron HCl
Alosetron HCl is synthesized via multi-step processes involving protection, functionalization, and deprotection of key intermediates. The synthesis typically requires careful control of reaction conditions, such as temperature and solvent choice, to achieve high yields and selectivity. Commonly used reagents include acetyl chloride, ethanol, and various protecting groups.

About

English Name Alosetron HCl
Molecular Formula C17H19ClN4O
Molecular Weight 330.82 g/mol
SMILES CC1=C(N=CN1)CN2CCC3=C(C2=O)C4=CC=CC=C4N3C.Cl
InChIKey FNYQZOVOVDSGJH-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Alosetron HCl (CAS: 122852-69-1)?

Alosetron HCl is a white or off-white crystalline powder with a molecular weight of approximately 41...

Compound Q&A

What industries use Alosetron HCl (CAS: 122852-69-1)?

Alosetron HCl is primarily used in the pharmaceutical industry for the treatment of irritable bowel ...

Compound Q&A

What precautions should be taken when handling Alosetron HCl (CAS: 122852-69-1)?

Alosetron HCl should be handled under mechanical ventilation to avoid inhalation of dust. Use approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...