Compound Q&A

What industries use 2-(2,4-Dihydroxyphenyl)-5-hydroxy-8,8-dimethyl-3-(3-methyl-2-buten-1-yl)-4H,8H-pyrano[2,3-f]chromen-4-one (CAS: 62596-29-6)?

Answer

2-(2,4-Dihydroxyphenyl)-5-hydroxy-8,8-dimethyl-3-(3-methyl-2-buten-1-yl)-4H,8H-pyrano[2,3-f]chromen-4-one
This compound is used in the pharmaceutical industry for the development of novel drugs with specific biological activities. It also finds applications in the chemical industry, particularly in the production of functional materials and sensors. Its unique structure makes it useful in various sectors including polymers and semiconductors.

About

CAS No 62596-29-6
English Name 2-(2,4-Dihydroxyphenyl)-5-hydroxy-8,8-dimethyl-3-(3-methyl-2-buten-1-yl)-4H,8H-pyrano[2,3-f]chromen-4-one
Molecular Formula C25H24O6
Molecular Weight 420.46 g/mol
SMILES CC(=CCc1c(=O)c2c(cc3c(c2oc1c4ccc(cc4O)O)C=CC(O3)(C)C)O)C
InChIKey XFFOMNJIDRDDLQ-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2,4-Dihydroxyphenyl)-5-hydroxy-8,8-dimethyl-3-(3-methyl-2-buten-1-yl)-4H,8H-pyrano[2,3-f]chromen-4-one (CAS: 62596-29-6)?

This compound is typically a solid with a crystalline form. It has a molecular weight of approximate...

Compound Q&A

How is 2-(2,4-Dihydroxyphenyl)-5-hydroxy-8,8-dimethyl-3-(3-methyl-2-buten-1-yl)-4H,8H-pyrano[2,3-f]chromen-4-one (CAS: 62596-29-6) typically synthesized?

The synthesis involves a multi-step process including condensation reactions, alkylation, and oxidat...

Compound Q&A

What precautions should be taken when handling 2-(2,4-Dihydroxyphenyl)-5-hydroxy-8,8-dimethyl-3-(3-methyl-2-buten-1-yl)-4H,8H-pyrano[2,3-f]chromen-4-one (CAS: 62596-29-6)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...