Compound Q&A

What industries use VA-044 (CAS: 27776-21-2)?

Answer

VA-044
VA-044 is primarily used in the pharmaceutical and polymer industries. It serves as a key intermediate in the synthesis of various pharmaceutical compounds and is also employed in the development of novel polymers for electronic and optoelectronic applications. Its unique properties make it valuable in these and other high-tech sectors.

About

CAS No 27776-21-2
English Name VA-044
Molecular Formula C12H24Cl2N6
Molecular Weight 323.27 g/mol
SMILES CC(C)(C1=NCCN1)N=NC(C)(C)C2=NCCN2.Cl.Cl
InChIKey LBSPZZSGTIBOFG-QIKYXUGXSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of VA-044 (CAS: 27776-21-2)?

VA-044 is a crystalline compound with a molecular weight of approximately 498.6 g/mol. It is slightl...

Compound Q&A

How is VA-044 (CAS: 27776-21-2) typically synthesized?

VA-044 is synthesized via a multi-step process involving the coupling of a vinyl triflate derivative...

Compound Q&A

What precautions should be taken when handling VA-044 (CAS: 27776-21-2)?

When handling VA-044, it is important to wear appropriate personal protective equipment (PPE) such a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...