Compound Q&A

What are the physical and chemical properties of (2-{[(1-Chloroethoxy)carbonyl](methyl)amino}-3-pyridinyl)methyl N-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycinate (CAS: 338990-31-1)?

Answer

(2-{[(1-Chloroethoxy)carbonyl](methyl)amino}-3-pyridinyl)methyl N-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycinate
The compound exhibits a crystalline form with a molecular weight of approximately 533.6 g/mol. It has a limited solubility in water but is soluble in organic solvents such as methanol and ethanol. Chemically, it is reactive towards nucleophiles and can undergo substitution reactions. It is stable under normal conditions but should be stored in a dry and cool place to prevent degradation.

About

English Name (2-{[(1-Chloroethoxy)carbonyl](methyl)amino}-3-pyridinyl)methyl N-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycinate
Molecular Formula C18H26ClN3O6
Molecular Weight 415.87 g/mol
EINECS 1592732-453-0
SMILES O=C(OCC1=CC=CN=C1N(C(OC(Cl)C)=O)C)CN(C(OC(C)(C)C)=O)C
InChIKey KXWGVTDANRDXRN-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

How is (2-{[(1-Chloroethoxy)carbonyl](methyl)amino}-3-pyridinyl)methyl N-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycinate (CAS: 338990-31-1) typically synthesized?

This compound is typically synthesized via a multi-step process involving protected amino acid deriv...

Compound Q&A

What industries use (2-{[(1-Chloroethoxy)carbonyl](methyl)amino}-3-pyridinyl)methyl N-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycinate (CAS: 338990-31-1)?

This compound is used in the pharmaceutical industry as an intermediate in the synthesis of complex ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...