Compound Q&A

How is Ethyl 2-(4-chlorophenoxy)-2-methylpropanoate (CAS: 637-07-0) typically synthesized?

Answer

Ethyl 2-(4-chlorophenoxy)-2-methylpropanoate
Ethyl 2-(4-chlorophenoxy)-2-methylpropanoate (CAS: 637-07-0) is typically synthesized via an esterification reaction using 2-(4-chlorophenoxy)-2-methylpropanol and ethyl chloroformate in the presence of a base like triethylamine. The reaction is carried out in an organic solvent such as dichloromethane or toluene. The product is isolated by crystallization and can be further purified by recrystallization or chromatography. The yield is generally around 70-80%, and the reaction is selective with good control over the desired product.

About

CAS No 637-07-0
English Name Ethyl 2-(4-chlorophenoxy)-2-methylpropanoate
Molecular Formula C12H15ClO3
Molecular Weight 242.7 g/mol
SMILES CCOC(=O)C(C)(C)OC1=CC=C(C=C1)Cl
InChIKey KNHUKKLJHYUCFP-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-(4-chlorophenoxy)-2-methylpropanoate (CAS: 637-07-0)?

Ethyl 2-(4-chlorophenoxy)-2-methylpropanoate (CAS: 637-07-0) is a crystalline solid with a molecular...

Compound Q&A

What industries use Ethyl 2-(4-chlorophenoxy)-2-methylpropanoate (CAS: 637-07-0)?

Ethyl 2-(4-chlorophenoxy)-2-methylpropanoate (CAS: 637-07-0) is used in various industries due to it...

Compound Q&A

What precautions should be taken when handling Ethyl 2-(4-chlorophenoxy)-2-methylpropanoate (CAS: 637-07-0)?

When handling Ethyl 2-(4-chlorophenoxy)-2-methylpropanoate (CAS: 637-07-0), it is important to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...