Compound Q&A

What are the physical and chemical properties of 5-Bromo-2-chloronicotinic acid (CAS: 29241-65-4)?

Answer

5-Bromo-2-chloronicotinic acid
5-Bromo-2-chloronicotinic acid is a crystalline solid with a molecular weight of approximately 211.01 g/mol. It has a solubility of about 0.3 g/L in water at 25°C. The compound is moderately reactive, showing basic properties due to the carboxylic acid functionality. It does not decompose under normal storage conditions but may undergo hydrolysis at elevated temperatures or in the presence of moisture.

About

CAS No 29241-65-4
English Name 5-Bromo-2-chloronicotinic acid
Molecular Formula C6H3BrClNO2
Molecular Weight 236.45 g/mol
SMILES C1=C(C=NC(=C1C(=O)O)Cl)Br
InChIKey UKNYSJCAGUXDOQ-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

How is 5-Bromo-2-chloronicotinic acid (CAS: 29241-65-4) typically synthesized?

5-Bromo-2-chloronicotinic acid can be synthesized by bromination of 2-chloronicotinic acid. This is ...

Compound Q&A

What industries use 5-Bromo-2-chloronicotinic acid (CAS: 29241-65-4)?

5-Bromo-2-chloronicotinic acid is used in pharmaceuticals for the synthesis of certain drugs, partic...

Compound Q&A

What precautions should be taken when handling 5-Bromo-2-chloronicotinic acid (CAS: 29241-65-4)?

When handling 5-Bromo-2-chloronicotinic acid, it is essential to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...