Compound Q&A

What precautions should be taken when handling 11-(1-Piperazinyl)dibenzo[b,f][1,4]thiazepine dihydrochloride (CAS: 111974-74-4)?

Answer

11-(1-Piperazinyl)dibenzo[b,f][1,4]thiazepine dihydrochloride
When handling 11-(1-Piperazinyl)dibenzo[b,f][1,4]thiazepine dihydrochloride, it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Store it in a cool, dry place away from direct sunlight and strong acids. In case of a spill, ensure proper ventilation and use appropriate absorbents to contain the spill. Always consult the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

English Name 11-(1-Piperazinyl)dibenzo[b,f][1,4]thiazepine dihydrochloride
Molecular Formula C17H19Cl2N3S
Molecular Weight 368.33 g/mol
SMILES C1CN(CCN1)C2=NC3=CC=CC=C3SC4=CC=CC=C42.Cl.Cl
InChIKey PZQCQHZDUIIKFU-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 11-(1-Piperazinyl)dibenzo[b,f][1,4]thiazepine dihydrochloride (CAS: 111974-74-4)?

11-(1-Piperazinyl)dibenzo[b,f][1,4]thiazepine dihydrochloride is a crystalline solid with a molecula...

Compound Q&A

How is 11-(1-Piperazinyl)dibenzo[b,f][1,4]thiazepine dihydrochloride (CAS: 111974-74-4) typically synthesized?

11-(1-Piperazinyl)dibenzo[b,f][1,4]thiazepine dihydrochloride is synthesized through a multi-step pr...

Compound Q&A

What industries use 11-(1-Piperazinyl)dibenzo[b,f][1,4]thiazepine dihydrochloride (CAS: 111974-74-4)?

11-(1-Piperazinyl)dibenzo[b,f][1,4]thiazepine dihydrochloride is primarily used in the pharmaceutica...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...