Compound Q&A

What industries use N~5~-Carbamoyl-L-ornithine - 2-hydroxysuccinic acid (1:1) (CAS: 54940-97-5)?

Answer

N~5~-Carbamoyl-L-ornithine - 2-hydroxysuccinic acid (1:1)
N~5~-Carbamoyl-L-ornithine - 2-hydroxysuccinic acid (1:1) finds applications in various industries. It is used in pharmaceuticals for its potential in drug development, particularly in the synthesis of certain biologically active compounds. It is also utilized in the production of polymers and sensors due to its unique chemical properties. Additionally, it has shown promise in the semiconductor industry as a precursor in the fabrication of electronic materials.

About

CAS No 54940-97-5
English Name N~5~-Carbamoyl-L-ornithine - 2-hydroxysuccinic acid (1:1)
Molecular Formula C10H19N3O8
Molecular Weight 309.28 g/mol
SMILES C(CC(C(=O)O)N)CNC(=O)N.C(C(C(=O)O)O)C(=O)O
InChIKey DROVUXYZTXCEBX-WCCKRBBISA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of N~5~-Carbamoyl-L-ornithine - 2-hydroxysuccinic acid (1:1) (CAS: 54940-97-5)?

N~5~-Carbamoyl-L-ornithine - 2-hydroxysuccinic acid (1:1) is a solid crystalline compound with a mol...

Compound Q&A

How is N~5~-Carbamoyl-L-ornithine - 2-hydroxysuccinic acid (1:1) (CAS: 54940-97-5) typically synthesized?

N~5~-Carbamoyl-L-ornithine - 2-hydroxysuccinic acid (1:1) is synthesized through a multi-step proces...

Compound Q&A

What precautions should be taken when handling N~5~-Carbamoyl-L-ornithine - 2-hydroxysuccinic acid (1:1) (CAS: 54940-97-5)?

When handling N~5~-Carbamoyl-L-ornithine - 2-hydroxysuccinic acid (1:1), it is crucial to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...