Compound Q&A

What precautions should be taken when handling 2,2-Dibutyl-1,3,2-dioxastannepine-4,7-dione (CAS: 78-04-6)?

Answer

2,2-Dibutyl-1,3,2-dioxastannepine-4,7-dione
When handling 2,2-Dibutyl-1,3,2-dioxastannepine-4,7-dione, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or under a fume hood to minimize exposure. Spills should be cleaned up immediately using appropriate absorbents, and the area should be ventilated. Refer to the Safety Data Sheet (SDS) for detailed emergency procedures and handling guidelines.

About

CAS No 78-04-6
English Name 2,2-Dibutyl-1,3,2-dioxastannepine-4,7-dione
Molecular Formula C12H20O4Sn
Molecular Weight 346.99 g/mol
SMILES CCCC[Sn]1(OC(=O)C=CC(=O)O1)CCCC
InChIKey ZBBLRPRYYSJUCZ-GRHBHMESSA-L
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2-Dibutyl-1,3,2-dioxastannepine-4,7-dione (CAS: 78-04-6)?

2,2-Dibutyl-1,3,2-dioxastannepine-4,7-dione is a white crystalline solid with a molecular weight of ...

Compound Q&A

How is 2,2-Dibutyl-1,3,2-dioxastannepine-4,7-dione (CAS: 78-04-6) typically synthesized?

2,2-Dibutyl-1,3,2-dioxastannepine-4,7-dione can be synthesized through organotin chemistry using dib...

Compound Q&A

What industries use 2,2-Dibutyl-1,3,2-dioxastannepine-4,7-dione (CAS: 78-04-6)?

2,2-Dibutyl-1,3,2-dioxastannepine-4,7-dione is primarily used in the pharmaceutical and polymer indu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...