Compound Q&A

What are the physical and chemical properties of (2S)-4-(Cyclohexyloxy)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid (CAS: 73821-95-1)?

Answer

(2S)-4-(Cyclohexyloxy)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid
This compound is a crystalline solid with a molecular weight of approximately 330.47 g/mol. It has a high solubility in organic solvents such as ethanol and acetone but is less soluble in water. Chemically, it is reactive and can undergo esterification and amide formation. It is stable under normal conditions but should be stored away from strong acids and bases.

About

CAS No 73821-95-1
English Name (2S)-4-(Cyclohexyloxy)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid
Molecular Formula C15H25NO6
Molecular Weight 315.37 g/mol
SMILES CC(C)(C)OC(=O)NC(CC(=O)OC1CCCCC1)C(=O)O
InChIKey NLPQIWFEEKQBBN-NSHDSACASA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

How is (2S)-4-(Cyclohexyloxy)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid (CAS: 73821-95-1) typically synthesized?

This compound can be synthesized through a multi-step process involving the esterification of cycloh...

Compound Q&A

What industries use (2S)-4-(Cyclohexyloxy)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid (CAS: 73821-95-1)?

This compound is primarily used in the pharmaceutical industry for the synthesis of various drug mol...

Compound Q&A

What precautions should be taken when handling (2S)-4-(Cyclohexyloxy)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid (CAS: 73821-95-1)?

When handling this compound, it is important to use appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...