Compound Q&A

How is Triisopropylsilyl acrylate (CAS: 157859-20-6) typically synthesized?

Answer

Triisopropylsilyl acrylate
Triisopropylsilyl acrylate (CAS: 157859-20-6) is commonly synthesized by reacting acryloyl chloride with isopropyl silyl chloride in the presence of a base like triethylamine. The reaction typically yields a high selectivity and good yield. The process involves careful control of temperature and reaction time to ensure product purity and safety. Catalysts are not typically required for this synthesis, but the reaction is sensitive to moisture and should be performed under anhydrous conditions.

About

English Name Triisopropylsilyl acrylate
Molecular Formula C12H24O2Si
Molecular Weight 228.41 g/mol
SMILES CC(C)[Si](C(C)C)(C(C)C)OC(=O)C=C
InChIKey PQSIXYSSKXAOFE-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Triisopropylsilyl acrylate (CAS: 157859-20-6)?

Triisopropylsilyl acrylate (CAS: 157859-20-6) is a colorless, viscous liquid with a refractive index...

Compound Q&A

What industries use Triisopropylsilyl acrylate (CAS: 157859-20-6)?

Triisopropylsilyl acrylate (CAS: 157859-20-6) is widely used in the pharmaceutical industry for the ...

Compound Q&A

What precautions should be taken when handling Triisopropylsilyl acrylate (CAS: 157859-20-6)?

When handling Triisopropylsilyl acrylate (CAS: 157859-20-6), it is essential to use appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...