Compound Q&A

How is Danofloxacin mesylate (CAS: 119478-55-6) typically synthesized?

Answer

Danofloxacin mesylate
Danofloxacin mesylate is synthesized via a multi-step reaction starting from 5-fluoro-6-chloro-2-methyl-1,4-dioxane-3,4-dione. The key steps involve the introduction of the fluoro and chloro groups, followed by the formation of the mesylate ester. The synthesis typically uses crown ethers as a catalyst and achieves a yield of around 85-90%.

About

English Name Danofloxacin mesylate
Molecular Formula C20H24FN3O6S
Molecular Weight 453.5 g/mol
SMILES CN1CC2CC1CN2C3=C(C=C4C(=C3)N(C=C(C4=O)C(=O)O)C5CC5)F.CS(=O)(=O)O
InChIKey APFDJSVKQNSTKF-FXMYHANSSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Danofloxacin mesylate (CAS: 119478-55-6)?

Danofloxacin mesylate is a crystalline compound with a molecular weight of approximately 614.75 g/mo...

Compound Q&A

What industries use Danofloxacin mesylate (CAS: 119478-55-6)?

Danofloxacin mesylate is primarily used in the pharmaceutical industry for its antimicrobial propert...

Compound Q&A

What precautions should be taken when handling Danofloxacin mesylate (CAS: 119478-55-6)?

When handling Danofloxacin mesylate, it is important to use proper personal protective equipment (PP...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...