Compound Q&A

How is Danofloxacin mesylate (CAS: 119478-55-6) typically synthesized?

Answer

Danofloxacin mesylate
Danofloxacin mesylate is synthesized via a multi-step reaction starting from 5-fluoro-6-chloro-2-methyl-1,4-dioxane-3,4-dione. The key steps involve the introduction of the fluoro and chloro groups, followed by the formation of the mesylate ester. The synthesis typically uses crown ethers as a catalyst and achieves a yield of around 85-90%.

About

English Name Danofloxacin mesylate
Molecular Formula C20H24FN3O6S
Molecular Weight 453.5 g/mol
SMILES CN1CC2CC1CN2C3=C(C=C4C(=C3)N(C=C(C4=O)C(=O)O)C5CC5)F.CS(=O)(=O)O
InChIKey APFDJSVKQNSTKF-FXMYHANSSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Danofloxacin mesylate (CAS: 119478-55-6)?

Danofloxacin mesylate is a crystalline compound with a molecular weight of approximately 614.75 g/mo...

Compound Q&A

What industries use Danofloxacin mesylate (CAS: 119478-55-6)?

Danofloxacin mesylate is primarily used in the pharmaceutical industry for its antimicrobial propert...

Compound Q&A

What precautions should be taken when handling Danofloxacin mesylate (CAS: 119478-55-6)?

When handling Danofloxacin mesylate, it is important to use proper personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...