Compound Q&A

What industries use 4,4'-[(1E)-1-Triazene-1,3-diyl]dibenzenecarboximidamide (CAS: 536-71-0)?

Answer

4,4'-[(1E)-1-Triazene-1,3-diyl]dibenzenecarboximidamide
4,4'-[(1E)-1-Triazene-1,3-diyl]dibenzenecarboximidamide is primarily used in the pharmaceutical industry for the synthesis of certain drugs and intermediates. It also finds applications in the polymer industry as a precursor for the production of functional polymers. Additionally, it is utilized in the development of sensors and semiconductors due to its unique chemical properties.

About

CAS No 536-71-0
English Name 4,4'-[(1E)-1-Triazene-1,3-diyl]dibenzenecarboximidamide
Molecular Formula C14H15N7
Molecular Weight 281.323 g/mol
SMILES C1=CC(=CC=C1C(=N)N)NN=NC2=CC=C(C=C2)C(=N)N
InChIKey XNYZHCFCZNMTFY-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4'-[(1E)-1-Triazene-1,3-diyl]dibenzenecarboximidamide (CAS: 536-71-0)?

4,4'-[(1E)-1-Triazene-1,3-diyl]dibenzenecarboximidamide is a crystalline compound with a molecular w...

Compound Q&A

How is 4,4'-[(1E)-1-Triazene-1,3-diyl]dibenzenecarboximidamide (CAS: 536-71-0) typically synthesized?

4,4'-[(1E)-1-Triazene-1,3-diyl]dibenzenecarboximidamide can be synthesized through a multi-step proc...

Compound Q&A

What precautions should be taken when handling 4,4'-[(1E)-1-Triazene-1,3-diyl]dibenzenecarboximidamide (CAS: 536-71-0)?

When handling 4,4'-[(1E)-1-Triazene-1,3-diyl]dibenzenecarboximidamide, it is essential to wear appro...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...