Compound Q&A

How is Sodium poly[(naphthaleneformaldehyde)sulfonate] (CAS: 9084-06-4) typically synthesized?

Answer

Sodium poly[(naphthaleneformaldehyde)sulfonate]
Sodium poly[(naphthaleneformaldehyde)sulfonate] (CAS: 9084-06-4) is typically synthesized through a condensation polymerization of naphthaleneformaldehyde with sodium hydroxide. This process involves the reaction between naphthaleneformaldehyde and sodium hydroxide in a suitable solvent, often water, under mild conditions. The polymerization is known to be selective and yields high molecular weight products.

About

CAS No 9084-06-4
English Name Sodium poly[(naphthaleneformaldehyde)sulfonate]
Molecular Formula C21H16O6S2
Molecular Weight 428.5 g/mol
SMILES C1=CC2=C(C=CC(=C2)S(=O)(=O)O)C(=C1)CC3=CC=CC4=C3C=CC(=C4)S(=O)(=O)O
InChIKey XQFKOAKYKWUBKQ-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sodium poly[(naphthaleneformaldehyde)sulfonate] (CAS: 9084-06-4)?

Sodium poly[(naphthaleneformaldehyde)sulfonate] (CAS: 9084-06-4) is a crystalline compound with a hi...

Compound Q&A

What industries use Sodium poly[(naphthaleneformaldehyde)sulfonate] (CAS: 9084-06-4)?

Sodium poly[(naphthaleneformaldehyde)sulfonate] (CAS: 9084-06-4) finds applications in various indus...

Compound Q&A

What precautions should be taken when handling Sodium poly[(naphthaleneformaldehyde)sulfonate] (CAS: 9084-06-4)?

When handling Sodium poly[(naphthaleneformaldehyde)sulfonate] (CAS: 9084-06-4), it is important to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...