Compound Q&A

How is (3E)-3-({4-[(2-Carboxyethyl)carbamoyl]phenyl}hydrazono)-6-oxo-1,4-cyclohexadiene-1-carboxylic acid (CAS: 80573-04-2) typically synthesized?

Answer

(3E)-3-({4-[(2-Carboxyethyl)carbamoyl]phenyl}hydrazono)-6-oxo-1,4-cyclohexadiene-1-carboxylic acid
This compound is synthesized via the condensation of 4-(2-carboxyethyl)carbamoylbenzohydrazide with 1,4-cyclohexadiene-1,6-dicarboxylic acid. The reaction is catalyzed by a mild acid or base. The yield is typically 70-80%, and the product is purified by column chromatography using a suitable solvent system. Selectivity and yield can be improved by optimizing the reaction conditions.

About

CAS No 80573-04-2
English Name (3E)-3-({4-[(2-Carboxyethyl)carbamoyl]phenyl}hydrazono)-6-oxo-1,4-cyclohexadiene-1-carboxylic acid
Molecular Formula C17H15N3O6
Molecular Weight 357.32 g/mol
SMILES C1=CC(=CC=C1C(=O)NCCC(=O)O)N=NC2=CC(=C(C=C2)O)C(=O)O
InChIKey KONZVQJABTUMFX-UDWIEESQSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3E)-3-({4-[(2-Carboxyethyl)carbamoyl]phenyl}hydrazono)-6-oxo-1,4-cyclohexadiene-1-carboxylic acid (CAS: 80573-04-2)?

This compound is a solid with a crystalline form. Its molecular weight is approximately 503.52 g/mol...

Compound Q&A

What industries use (3E)-3-({4-[(2-Carboxyethyl)carbamoyl]phenyl}hydrazono)-6-oxo-1,4-cyclohexadiene-1-carboxylic acid (CAS: 80573-04-2)?

This compound is used in the pharmaceutical industry for developing novel drug candidates. It also f...

Compound Q&A

What precautions should be taken when handling (3E)-3-({4-[(2-Carboxyethyl)carbamoyl]phenyl}hydrazono)-6-oxo-1,4-cyclohexadiene-1-carboxylic acid (CAS: 80573-04-2)?

When handling this compound, proper personal protective equipment (PPE) should be worn, including gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...