Compound Q&A

How should 2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid (CAS: 3663-80-7) be stored?

Answer

2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid
2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid (CAS: 3663-80-7) should be stored in a cool, dry place away from direct sunlight and heat sources. It is recommended to store it in a tightly sealed container to prevent moisture and air exposure. Avoid storing it in high humidity areas or near sources of ignition to prevent degradation and potential hazards.

About

CAS No 3663-80-7
English Name 2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid
Molecular Formula C9H8O4
Molecular Weight 180.16 g/mol
SMILES C1C(OC2=CC=CC=C2O1)C(=O)O
InChIKey HMBHAQMOBKLWRX-UHFFFAOYSA-N
Last Updated: 2025-09-07 00:47

Related Q&A

Compound Q&A

What is 2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid (CAS: 3663-80-7)?

2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid, also known as 2-(3,4-dihydro-2H-1,4-benzodioxin-3-yl...

Compound Q&A

What are the main uses of 2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid (CAS: 3663-80-7)?

2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid (CAS: 3663-80-7) is primarily used in the pharmaceuti...

Compound Q&A

Is 2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid (CAS: 3663-80-7) safe?

2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid (CAS: 3663-80-7) is generally safe when handled prope...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...