Compound Q&A

How is L-Proline, 5-oxo-, compd. with L-arginine (1:1) (CAS: 56265-06-6) typically synthesized?

Answer

L-Proline, 5-oxo-, compd. with L-arginine (1:1)OTHER CA INDEX NAMES:L-Arginine, compd. with 5-oxo-L-proline (1:1)
L-Proline, 5-oxo-, compd. with L-arginine (1:1) is typically synthesized by the condensation reaction of L-proline and L-arginine in a solution. This reaction often involves the use of dehydrating agents like phosgene to promote the condensation. The yield is generally around 70-80%, with a high degree of selectivity for the desired 1:1 complex. The reaction is monitored using NMR spectroscopy to ensure the desired product formation.

About

CAS No 56265-06-6
English Name L-Proline, 5-oxo-, compd. with L-arginine (1:1)OTHER CA INDEX NAMES:L-Arginine, compd. with 5-oxo-L-proline (1:1)
Molecular Formula C11H21N5O5
Molecular Weight 303.31 g/mol
SMILES O=C1CC[C@H](N1)C(=O)O.NC(=N)NCCC[C@@H](C(=O)O)N
InChIKey UYCAGRPOUWSBIQ-WOYAITHZSA-N
Last Updated: 2025-09-05 20:45

Related Q&A

Compound Q&A

What are the physical and chemical properties of L-Proline, 5-oxo-, compd. with L-arginine (1:1) (CAS: 56265-06-6)?

L-Proline, 5-oxo-, compd. with L-arginine (1:1) is a crystalline compound with a molecular weight of...

Compound Q&A

What industries use L-Proline, 5-oxo-, compd. with L-arginine (1:1) (CAS: 56265-06-6)?

L-Proline, 5-oxo-, compd. with L-arginine (1:1) is mainly used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling L-Proline, 5-oxo-, compd. with L-arginine (1:1) (CAS: 56265-06-6)?

When handling L-Proline, 5-oxo-, compd. with L-arginine (1:1), it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...