Compound Q&A

What industries use 2,4,6,8-Tetramethyl-2,4,6,8-tetravinyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane (CAS: 2554-06-5)?

Answer

2,4,6,8-Tetramethyl-2,4,6,8-tetravinyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane
This compound is primarily used in the pharmaceuticals industry for the synthesis of complex organic molecules. It is also utilized in the polymer industry for the development of advanced materials. Additionally, it finds applications in sensor technology and semiconductor manufacturing due to its unique reactivity and stability.

About

CAS No 2554-06-5
English Name 2,4,6,8-Tetramethyl-2,4,6,8-tetravinyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane
Molecular Formula C12H24O4Si4
Molecular Weight 344.66 g/mol
SMILES C[Si]1(O[Si](O[Si](O[Si](O1)(C)C=C)(C)C=C)(C)C=C)C=C
InChIKey VMAWODUEPLAHOE-UHFFFAOYSA-N
Last Updated: 2025-09-05 20:45

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4,6,8-Tetramethyl-2,4,6,8-tetravinyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane (CAS: 2554-06-5)?

The compound is a solid with a crystalline form. It has a high molecular weight and low solubility i...

Compound Q&A

How is 2,4,6,8-Tetramethyl-2,4,6,8-tetravinyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane (CAS: 2554-06-5) typically synthesized?

The compound is synthesized via a multistep process involving vinyl chloride polymerization, followe...

Compound Q&A

What precautions should be taken when handling 2,4,6,8-Tetramethyl-2,4,6,8-tetravinyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane (CAS: 2554-06-5)?

Proper personal protective equipment (PPE) including gloves and goggles should be worn. The compound...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...