Compound Q&A

How is 2-Methyl-2-propanyl 4-oxo-1-azepanecarboxylate (CAS: 188975-88-4) typically synthesized?

Answer

2-Methyl-2-propanyl 4-oxo-1-azepanecarboxylate
2-Methyl-2-propanyl 4-oxo-1-azepanecarboxylate (CAS: 188975-88-4) is typically synthesized via the condensation of 2-methyl-2-propanoyl chloride with 4-oxo-1-azepanecarboxylic acid. This reaction is often catalyzed by a strong base such as sodium hydride, and the yield is typically around 70-80%. The reaction is highly selective, and the product can be purified by recrystallization from ethanol.

About

English Name 2-Methyl-2-propanyl 4-oxo-1-azepanecarboxylate
Molecular Formula C11H19NO3
Molecular Weight 213.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCCC(=O)CC1
InChIKey PMLBUVZPRKXMOX-UHFFFAOYSA-N
Last Updated: 2025-09-05 20:45

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-oxo-1-azepanecarboxylate (CAS: 188975-88-4)?

2-Methyl-2-propanyl 4-oxo-1-azepanecarboxylate (CAS: 188975-88-4) has a crystalline form with a mole...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-oxo-1-azepanecarboxylate (CAS: 188975-88-4)?

2-Methyl-2-propanyl 4-oxo-1-azepanecarboxylate (CAS: 188975-88-4) is used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-oxo-1-azepanecarboxylate (CAS: 188975-88-4)?

When handling 2-Methyl-2-propanyl 4-oxo-1-azepanecarboxylate (CAS: 188975-88-4), it is important to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...