Compound Q&A

How is 2,2'-[2,2-Propanediylbis(4,1-phenyleneoxymethylene)]dioxirane (CAS: 1675-54-3) typically synthesized?

Answer

2,2'-[2,2-Propanediylbis(4,1-phenyleneoxymethylene)]dioxirane
2,2'-[2,2-Propanediylbis(4,1-phenyleneoxymethylene)]dioxirane (CAS: 1675-54-3) is typically synthesized via a ring-opening polymerization of dihydroxydiphenyl ether followed by dioxirane formation. This process often involves the use of Lewis acids as catalysts to enhance the ring-opening step. The yield and selectivity can be improved by optimizing reaction conditions such as temperature and concentration of catalysts.

About

CAS No 1675-54-3
English Name 2,2'-[2,2-Propanediylbis(4,1-phenyleneoxymethylene)]dioxirane
Molecular Formula C21H24O4
Molecular Weight 340.42 g/mol
SMILES CC(C)(c1ccc(OCC2CO2)cc1)c3ccc(OCC4CO4)cc3
InChIKey LCFVJGUPQDGYKZ-UHFFFAOYSA-N
Last Updated: 2025-09-05 20:45

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2'-[2,2-Propanediylbis(4,1-phenyleneoxymethylene)]dioxirane (CAS: 1675-54-3)?

2,2'-[2,2-Propanediylbis(4,1-phenyleneoxymethylene)]dioxirane (CAS: 1675-54-3) is a colorless, clear...

Compound Q&A

What industries use 2,2'-[2,2-Propanediylbis(4,1-phenyleneoxymethylene)]dioxirane (CAS: 1675-54-3)?

2,2'-[2,2-Propanediylbis(4,1-phenyleneoxymethylene)]dioxirane (CAS: 1675-54-3) is utilized in variou...

Compound Q&A

What precautions should be taken when handling 2,2'-[2,2-Propanediylbis(4,1-phenyleneoxymethylene)]dioxirane (CAS: 1675-54-3)?

When handling 2,2'-[2,2-Propanediylbis(4,1-phenyleneoxymethylene)]dioxirane (CAS: 1675-54-3), it is ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...