Compound Q&A

What industries use Dimethyl 2,6-pyridinedicarboxylate (CAS: 5453-67-8)?

Answer

Dimethyl 2,6-pyridinedicarboxylate
Dimethyl 2,6-pyridinedicarboxylate (CAS: 5453-67-8) is used in the pharmaceutical industry for the synthesis of certain drugs, in the polymer industry for the production of functionalized polymers, and in the sensor industry for the development of chemical sensors due to its reactivity and stability.

About

CAS No 5453-67-8
English Name Dimethyl 2,6-pyridinedicarboxylate
Molecular Formula C9H9NO4
Molecular Weight 195.17 g/mol
SMILES COC(=O)C1=NC(=CC=C1)C(=O)OC
InChIKey SNQQJEJPJMXYTR-UHFFFAOYSA-N
Last Updated: 2025-09-05 20:45

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dimethyl 2,6-pyridinedicarboxylate (CAS: 5453-67-8)?

Dimethyl 2,6-pyridinedicarboxylate (CAS: 5453-67-8) is a crystalline solid with a molecular weight o...

Compound Q&A

How is Dimethyl 2,6-pyridinedicarboxylate (CAS: 5453-67-8) typically synthesized?

Dimethyl 2,6-pyridinedicarboxylate (CAS: 5453-67-8) is commonly synthesized via the reaction of 2,6-...

Compound Q&A

What precautions should be taken when handling Dimethyl 2,6-pyridinedicarboxylate (CAS: 5453-67-8)?

When handling Dimethyl 2,6-pyridinedicarboxylate (CAS: 5453-67-8), it is essential to wear personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...