Compound Q&A

What precautions should be taken when handling 2-Amino-6-fluorobenzoic acid (CAS: 434-76-4)?

Answer

2-Amino-6-fluorobenzoic acid
When handling 2-Amino-6-fluorobenzoic acid, it is essential to use appropriate personal protective equipment such as gloves, goggles, and a lab coat. It should be stored in a cool, dry place away from light and moisture. In case of a spill, it is recommended to use appropriate absorbents and follow local safety guidelines. Always consult the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

CAS No 434-76-4
English Name 2-Amino-6-fluorobenzoic acid
Molecular Formula C7H6FNO2
Molecular Weight 155.13 g/mol
SMILES C1=CC(=C(C(=C1)F)C(=O)O)N
InChIKey RWSFZKWMVWPDGZ-UHFFFAOYSA-N
Last Updated: 2025-09-05 20:45

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-6-fluorobenzoic acid (CAS: 434-76-4)?

2-Amino-6-fluorobenzoic acid is a crystalline solid with a molecular weight of approximately 191.07 ...

Compound Q&A

How is 2-Amino-6-fluorobenzoic acid (CAS: 434-76-4) typically synthesized?

2-Amino-6-fluorobenzoic acid is commonly synthesized through the reaction of 6-fluorobenzoic acid wi...

Compound Q&A

What industries use 2-Amino-6-fluorobenzoic acid (CAS: 434-76-4)?

2-Amino-6-fluorobenzoic acid is used in the pharmaceutical industry for the synthesis of certain dru...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...