Compound Q&A

What are the main uses of 3-Methylbutyl 4-(dimethylamino)benzoate (CAS: 21245-01-2)?

Answer

3-Methylbutyl 4-(dimethylamino)benzoate
3-Methylbutyl 4-(dimethylamino)benzoate is primarily used as a pharmaceutical intermediate. It is also utilized in the synthesis of other organic compounds and as a reagent in various chemical reactions. Additionally, it is sometimes used in laboratory research for specific applications.

About

CAS No 21245-01-2
English Name 3-Methylbutyl 4-(dimethylamino)benzoate
Molecular Formula C14H21NO2
Molecular Weight 235.33 g/mol
SMILES O=C(OCCC(C)C)C1=CC=C(N(C)C)C=C1
InChIKey OFSAUHSCHWRZKM-UHFFFAOYSA-N
Last Updated: 2025-09-04 23:41

Related Q&A

Compound Q&A

What is 3-Methylbutyl 4-(dimethylamino)benzoate (CAS: 21245-01-2)?

3-Methylbutyl 4-(dimethylamino)benzoate is a compound with the chemical formula C12H17NO2. It is a d...

Compound Q&A

Is 3-Methylbutyl 4-(dimethylamino)benzoate (CAS: 21245-01-2) safe?

3-Methylbutyl 4-(dimethylamino)benzoate is generally considered safe under normal laboratory conditi...

Compound Q&A

How should 3-Methylbutyl 4-(dimethylamino)benzoate (CAS: 21245-01-2) be stored?

3-Methylbutyl 4-(dimethylamino)benzoate should be stored in a cool, dry place, away from direct sunl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...