Compound Q&A

What are the main uses of 2-(Carboxymethyl)benzoic acid (CAS: 89-51-0)?

Answer

2-(Carboxymethyl)benzoic acid
2-(Carboxymethyl)benzoic acid is primarily used in the pharmaceutical industry as a starting material for the synthesis of various drugs. It also serves as a precursor in the production of agrochemicals and is used in the formulation of some food additives. Additionally, it is utilized in research and development for its unique chemical properties.

About

CAS No 89-51-0
English Name 2-(Carboxymethyl)benzoic acid
Molecular Formula C9H8O4
Molecular Weight 180.16 g/mol
SMILES C1=CC=C(C(=C1)CC(=O)O)C(=O)O
InChIKey ZHQLTKAVLJKSKR-UHFFFAOYSA-N
Last Updated: 2025-09-04 23:41

Related Q&A

Compound Q&A

What is 2-(Carboxymethyl)benzoic acid (CAS: 89-51-0)?

2-(Carboxymethyl)benzoic acid is a carboxylic acid with the chemical formula C8H7CO2CH2CO2H. It is a...

Compound Q&A

Is 2-(Carboxymethyl)benzoic acid (CAS: 89-51-0) safe?

2-(Carboxymethyl)benzoic acid is generally safe when handled properly. It is mildly corrosive to ski...

Compound Q&A

How should 2-(Carboxymethyl)benzoic acid (CAS: 89-51-0) be stored?

2-(Carboxymethyl)benzoic acid should be stored in a cool, dry place away from heat and direct sunlig...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...