Compound Q&A

What is N-(Cyanomethyl)-4-(trifluoromethyl)nicotinamide (CAS: 158062-67-0)?

Answer

N-(Cyanomethyl)-4-(trifluoromethyl)nicotinamide
N-(Cyanomethyl)-4-(trifluoromethyl)nicotinamide is a scientific compound with the CAS number 158062-67-0. It has a chemical formula of C9H5F3N2O2 and is a white or off-white solid at room temperature. This compound is characterized by its stability and unique chemical properties, making it suitable for various applications in scientific research and pharmaceuticals.

About

English Name N-(Cyanomethyl)-4-(trifluoromethyl)nicotinamide
Molecular Formula C9H6F3N3O
Molecular Weight 218.18 g/mol
SMILES FC(F)(F)c1ccncc1C(=O)NCC#N
InChIKey RLQJEEJISHYWON-UHFFFAOYSA-N
Last Updated: 2025-09-04 23:41

Related Q&A

Compound Q&A

What are the main uses of N-(Cyanomethyl)-4-(trifluoromethyl)nicotinamide (CAS: 158062-67-0)?

N-(Cyanomethyl)-4-(trifluoromethyl)nicotinamide is primarily used in the pharmaceutical industry as ...

Compound Q&A

Is N-(Cyanomethyl)-4-(trifluoromethyl)nicotinamide (CAS: 158062-67-0) safe?

N-(Cyanomethyl)-4-(trifluoromethyl)nicotinamide is generally considered safe when handled properly. ...

Compound Q&A

How should N-(Cyanomethyl)-4-(trifluoromethyl)nicotinamide (CAS: 158062-67-0) be stored?

N-(Cyanomethyl)-4-(trifluoromethyl)nicotinamide should be stored in a cool, dry place away from dire...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...