Compound Q&A

What are the main uses of 2-Hydroxy-5-[(E)-2-(4-nitrophenyl)diazen-1-yl]benzoic acid (CAS: 2243-76-7)?

Answer

2-Hydroxy-5-[(E)-2-(4-nitrophenyl)diazen-1-yl]benzoic acid
This compound is primarily used in the pharmaceutical industry as an intermediate for the synthesis of other drugs. It also has applications in the analytical chemistry field for the development of chromogenic reagents and in research for its reactivity with various functional groups.

About

CAS No 2243-76-7
English Name 2-Hydroxy-5-[(E)-2-(4-nitrophenyl)diazen-1-yl]benzoic acid
Molecular Formula C13H9N3O5
Molecular Weight 287.23 g/mol
SMILES C1=CC(=CC=C1N=NC2=CC(=C(C=C2)O)C(=O)O)[N+](=O)[O-]
InChIKey YVJPMMYYRNHJAU-UHFFFAOYSA-N
Last Updated: 2025-09-04 23:41

Related Q&A

Compound Q&A

What is 2-Hydroxy-5-[(E)-2-(4-nitrophenyl)diazen-1-yl]benzoic acid (CAS: 2243-76-7)?

2-Hydroxy-5-[(E)-2-(4-nitrophenyl)diazen-1-yl]benzoic acid is a chemical compound with the CAS numbe...

Compound Q&A

Is 2-Hydroxy-5-[(E)-2-(4-nitrophenyl)diazen-1-yl]benzoic acid (CAS: 2243-76-7) safe?

The compound is generally stable and non-toxic, but it can cause skin irritation. Handling should be...

Compound Q&A

How should 2-Hydroxy-5-[(E)-2-(4-nitrophenyl)diazen-1-yl]benzoic acid (CAS: 2243-76-7) be stored?

Store in a cool, dry place away from direct sunlight and heat sources. Keep container tightly closed...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...