Compound Q&A

What are the main uses of (2R)-(2-Formylphenyl)(hydroxy)acetyl chloride (CAS: 29169-64-0)?

Answer

(2R)-(2-Formylphenyl)(hydroxy)acetyl chloride
This compound is primarily used in the synthesis of pharmaceuticals, where it serves as an intermediate in drug development. It is also utilized in the preparation of various organic compounds and as a reagent in organic chemistry research. Its reactivity makes it a valuable tool in chemical synthesis processes.

About

CAS No 29169-64-0
English Name (2R)-(2-Formylphenyl)(hydroxy)acetyl chloride
Molecular Formula C9H7ClO3
Molecular Weight 198.6 g/mol
SMILES C1=CC=C(C=C1)C(C(=O)Cl)OC=O
InChIKey UYKPLMSGXQWXQU-MRVPVSSYSA-N
Last Updated: 2025-09-04 23:41

Related Q&A

Compound Q&A

What is (2R)-(2-Formylphenyl)(hydroxy)acetyl chloride (CAS: 29169-64-0)?

This compound is a chemical with the CAS number 29169-64-0, also known as (2R)-(2-formylphenyl)(hydr...

Compound Q&A

Is (2R)-(2-Formylphenyl)(hydroxy)acetyl chloride (CAS: 29169-64-0) safe?

While (2R)-(2-formylphenyl)(hydroxy)acetyl chloride is generally considered safe for laboratory use,...

Compound Q&A

How should (2R)-(2-Formylphenyl)(hydroxy)acetyl chloride (CAS: 29169-64-0) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...