Compound Q&A

What is (-)-Catechin gallate (CAS: 130405-40-2)?

Answer

(-)-Catechin gallate
(-)-Catechin gallate is a polyphenolic compound with the chemical formula C22H18O11. It is a type of flavonoid, specifically a catechin derivative conjugated with a gallic acid moiety. This compound exhibits antioxidant and anti-inflammatory properties, making it valuable in various applications.

About

English Name (-)-Catechin gallate
Molecular Formula C22H18O10
Molecular Weight 442.38 g/mol
SMILES OC1=CC(O)=C2C[C@@H](OC(=O)C3=CC(O)=C(O)C(O)=C3)[C@@H](OC2=C1)C1=CC(O)=C(O)C=C1
InChIKey LSHVYAFMTMFKBA-CTNGQTDRSA-N
Last Updated: 2025-09-04 23:41

Related Q&A

Compound Q&A

What are the main uses of (-)-Catechin gallate (CAS: 130405-40-2)?

(-)-Catechin gallate is primarily used in the pharmaceutical and food industries for its antioxidant...

Compound Q&A

Is (-)-Catechin gallate (CAS: 130405-40-2) safe?

(-)-Catechin gallate is generally considered safe for ingestion and topical use. However, it is advi...

Compound Q&A

How should (-)-Catechin gallate (CAS: 130405-40-2) be stored?

(-)-Catechin gallate should be stored in a tightly sealed container at room temperature, away from d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...