Compound Q&A

What is 3,8-Diamino-5-{3-[diethyl(methyl)ammonio]propyl}-6-phenylphenanthridinium diiodide (CAS: 25535-16-4)?

Answer

3,8-Diamino-5-{3-[diethyl(methyl)ammonio]propyl}-6-phenylphenanthridinium diiodide
3,8-Diamino-5-{3-[diethyl(methyl)ammonio]propyl}-6-phenylphenanthridinium diiodide is a complex organic compound, characterized by its aromatic structure and positive charge from the iodide ions. It has potential applications in the field of molecular recognition and sensing due to its unique chemical properties.

About

CAS No 25535-16-4
English Name 3,8-Diamino-5-{3-[diethyl(methyl)ammonio]propyl}-6-phenylphenanthridinium diiodide
Molecular Formula C27H34I2N4
Molecular Weight 668.4 g/mol
SMILES CC[N+](C)(CC)CCC[N+]1=C2C=C(C=CC2=C3C=CC(=CC3=C1C4=CC=CC=C4)N)N.[I-].[I-]
InChIKey XJMOSONTPMZWPB-UHFFFAOYSA-M
Last Updated: 2025-09-04 23:41

Related Q&A

Compound Q&A

What are the main uses of 3,8-Diamino-5-{3-[diethyl(methyl)ammonio]propyl}-6-phenylphenanthridinium diiodide (CAS: 25535-16-4)?

This compound is primarily used in molecular recognition technologies and as a sensing material in a...

Compound Q&A

Is 3,8-Diamino-5-{3-[diethyl(methyl)ammonio]propyl}-6-phenylphenanthridinium diiodide (CAS: 25535-16-4) safe?

While the compound is not inherently toxic, handling should be done with caution. Protective measure...

Compound Q&A

How should 3,8-Diamino-5-{3-[diethyl(methyl)ammonio]propyl}-6-phenylphenanthridinium diiodide (CAS: 25535-16-4) be stored?

Store the compound in a cool, dry place, away from direct sunlight and heat sources. Use a tightly s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...