Compound Q&A

What are the main uses of (4-Isopropylphenyl)boronic acid (CAS: 16152-51-5)?

Answer

(4-Isopropylphenyl)boronic acid
(4-Isopropylphenyl)boronic acid is primarily used in the field of organic synthesis, particularly in the preparation of boronic esters and boronic acids. It serves as a key reagent in Suzuki-Miyaura coupling reactions, where it facilitates the formation of carbon-carbon bonds under catalytic conditions. This compound is also used in the synthesis of pharmaceuticals and agrochemicals.

About

CAS No 16152-51-5
English Name (4-Isopropylphenyl)boronic acid
Molecular Formula C9H13BO2
Molecular Weight 164.01 g/mol
SMILES B(C1=CC=C(C=C1)C(C)C)(O)O
InChIKey IAEUFBDMVKQCLU-UHFFFAOYSA-N
Last Updated: 2025-09-04 23:41

Related Q&A

Compound Q&A

What is (4-Isopropylphenyl)boronic acid (CAS: 16152-51-5)?

(4-Isopropylphenyl)boronic acid is an organoboron compound with the chemical formula C11H15BO2. It i...

Compound Q&A

Is (4-Isopropylphenyl)boronic acid (CAS: 16152-51-5) safe?

(4-Isopropylphenyl)boronic acid is generally considered safe under normal handling conditions. Howev...

Compound Q&A

How should (4-Isopropylphenyl)boronic acid (CAS: 16152-51-5) be stored?

(4-Isopropylphenyl)boronic acid should be stored in a cool, dry place with a temperature not exceedi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...