Compound Q&A

How should 2-(Trifluoromethyl)benzoyl chloride (CAS: 312-94-7) be stored?

Answer

2-(Trifluoromethyl)benzoyl chloride
2-(Trifluoromethyl)benzoyl chloride should be stored in a cool, dry place, away from direct sunlight and heat sources. Maintain a temperature below 25°C and keep the container tightly sealed to prevent degradation. Store in a well-ventilated area and use a non-flammable container to minimize fire risks.

About

CAS No 312-94-7
English Name 2-(Trifluoromethyl)benzoyl chloride
Molecular Formula C8H4ClF3O
Molecular Weight 208.57 g/mol
SMILES C1=CC=C(C(=C1)C(=O)Cl)C(F)(F)F
InChIKey MXIUWSYTQJLIKE-UHFFFAOYSA-N
Last Updated: 2025-09-04 23:41

Related Q&A

Compound Q&A

What is 2-(Trifluoromethyl)benzoyl chloride (CAS: 312-94-7)?

2-(Trifluoromethyl)benzoyl chloride is a chlorinated aromatic compound. Its chemical formula is C9H5...

Compound Q&A

What are the main uses of 2-(Trifluoromethyl)benzoyl chloride (CAS: 312-94-7)?

2-(Trifluoromethyl)benzoyl chloride is primarily used as a starting material in the synthesis of pha...

Compound Q&A

Is 2-(Trifluoromethyl)benzoyl chloride (CAS: 312-94-7) safe?

2-(Trifluoromethyl)benzoyl chloride is moderately toxic and requires proper handling. It is importan...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...