Compound Q&A

How should 2,2'-Bipyridine-4,4'-diyldimethanol (CAS: 109073-77-0) be stored?

Answer

2,2'-Bipyridine-4,4'-diyldimethanol
2,2'-Bipyridine-4,4'-diyldimethanol should be stored in a cool, dry place with a temperature below 25°C (77°F) and away from direct sunlight and heat sources. Maintain a relative humidity below 50% to prevent moisture absorption. Store it in a tightly sealed, amber glass or plastic container to protect it from light. Keep it away from incompatible materials such as strong oxidizers and acidic substances. Follow all storage and handling guidelines to ensure safety and stability.

About

English Name 2,2'-Bipyridine-4,4'-diyldimethanol
Molecular Formula C12H12N2O2
Molecular Weight 216.24 g/mol
SMILES C1=CN=C(C=C1CO)C2=NC=CC(=C2)CO
InChIKey RRXGRDMHWYLJSY-UHFFFAOYSA-N
Last Updated: 2025-09-04 23:41

Related Q&A

Compound Q&A

What is 2,2'-Bipyridine-4,4'-diyldimethanol (CAS: 109073-77-0)?

2,2'-Bipyridine-4,4'-diyldimethanol, also known as 2,2'-bipyridine-4,4'-diol, is a colorless or pale...

Compound Q&A

What are the main uses of 2,2'-Bipyridine-4,4'-diyldimethanol (CAS: 109077-0)?

2,2'-Bipyridine-4,4'-diyldimethanol is primarily used as a precursor in the synthesis of other compo...

Compound Q&A

Is 2,2'-Bipyridine-4,4'-diyldimethanol (CAS: 109073-77-0) safe?

2,2'-Bipyridine-4,4'-diyldimethanol is generally considered safe for handling when proper precaution...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...