Compound Q&A

What is 4-Ethyl-2,3-dioxo-1-piperazinecarbonyl chloride (CAS: 59703-00-3)?

Answer

4-Ethyl-2,3-dioxo-1-piperazinecarbonyl chloride
4-Ethyl-2,3-dioxo-1-piperazinecarbonyl chloride is an organic compound with the CAS number 59703-00-3. It has a molecular formula of C7H9ClNO4. This compound is characterized by its piperazine structure with an ethyl substituent and two oxygen atoms forming a dioxo group at the 2,3 positions.

About

CAS No 59703-00-3
English Name 4-Ethyl-2,3-dioxo-1-piperazinecarbonyl chloride
Molecular Formula C7H9ClN2O3
Molecular Weight 204.61 g/mol
SMILES CCN1CCN(C(=O)C1=O)C(=O)Cl
InChIKey SXVBQOZRZIUHKU-UHFFFAOYSA-N
Last Updated: 2025-09-04 23:41

Related Q&A

Compound Q&A

What are the main uses of 4-Ethyl-2,3-dioxo-1-piperazinecarbonyl chloride (CAS: 59703-00-3)?

4-Ethyl-2,3-dioxo-1-piperazinecarbonyl chloride is primarily used in the synthesis of various pharma...

Compound Q&A

Is 4-Ethyl-2,3-dioxo-1-piperazinecarbonyl chloride (CAS: 59703-00-3) safe?

4-Ethyl-2,3-dioxo-1-piperazinecarbonyl chloride is generally safe under controlled conditions. Howev...

Compound Q&A

How should 4-Ethyl-2,3-dioxo-1-piperazinecarbonyl chloride (CAS: 59703-00-3) be stored?

4-Ethyl-2,3-dioxo-1-piperazinecarbonyl chloride should be stored in a cool, dry place, away from hea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...