Compound Q&A

What is 3'-Amino-2'-hydroxy-3-biphenylcarboxylic acid (CAS: 376592-93-7)?

Answer

3'-Amino-2'-hydroxy-3-biphenylcarboxylic acid
3'-Amino-2'-hydroxy-3-biphenylcarboxylic acid (CAS: 376592-93-7) is an organic compound with the molecular formula C17H14O3N. It is a derivative of biphenyl with an amino group at the 3' position and a hydroxyl group at the 2' position. This compound is typically used in research and development due to its unique chemical structure.

About

English Name 3'-Amino-2'-hydroxy-3-biphenylcarboxylic acid
Molecular Formula C13H11NO3
Molecular Weight 229.23 g/mol
SMILES C1=CC(=CC(=C1)C(=O)O)C2=C(C(=CC=C2)N)O
InChIKey ZXLYSSHNDUXXIN-UHFFFAOYSA-N
Last Updated: 2025-09-04 23:41

Related Q&A

Compound Q&A

What are the main uses of 3'-Amino-2'-hydroxy-3-biphenylcarboxylic acid (CAS: 376592-93-7)?

3'-Amino-2'-hydroxy-3-biphenylcarboxylic acid (CAS: 376592-93-7) is primarily used in research and d...

Compound Q&A

Is 3'-Amino-2'-hydroxy-3-biphenylcarboxylic acid (CAS: 376592-93-7) safe?

3'-Amino-2'-hydroxy-3-biphenylcarboxylic acid (CAS: 376592-93-7) is generally considered safe when h...

Compound Q&A

How should 3'-Amino-2'-hydroxy-3-biphenylcarboxylic acid (CAS: 376592-93-7) be stored?

3'-Amino-2'-hydroxy-3-biphenylcarboxylic acid (CAS: 376592-93-7) should be stored in a cool, dry pla...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...