Compound Q&A

What is 2-Hydroxypropanoic acid - 5-(3,4,5-trimethoxybenzyl)-2,4-pyrimidinediamine (CAS: 23256-42-0)?

Answer

2-Hydroxypropanoic acid - 5-(3,4,5-trimethoxybenzyl)-2,4-pyrimidinediamine (1:1)
2-Hydroxypropanoic acid - 5-(3,4,5-trimethoxybenzyl)-2,4-pyrimidinediamine is a complex organic compound. It has the chemical formula C16H18N4O5. This compound is characterized by its acidity and its ability to form stable complexes with various metal ions.

About

CAS No 23256-42-0
English Name 2-Hydroxypropanoic acid - 5-(3,4,5-trimethoxybenzyl)-2,4-pyrimidinediamine (1:1)
Molecular Formula C17H24N4O6
Molecular Weight 380.4 g/mol
SMILES CC(C(=O)O)O.COC1=CC(=CC(=C1OC)OC)CC2=CN=C(N=C2N)N
InChIKey IIZVTUWSIKTFKO-UHFFFAOYSA-N
Last Updated: 2025-09-03 20:19

Related Q&A

Compound Q&A

What are the main uses of 2-Hydroxypropanoic acid - 5-(3,4,5-trimethoxybenzyl)-2,4-pyrimidinediamine (CAS: 23256-42-0)?

This compound is primarily used in the pharmaceutical industry for its potential as a chelating agen...

Compound Q&A

Is 2-Hydroxypropanoic acid - 5-(3,4,5-trimethoxybenzyl)-2,4-pyrimidinediamine (CAS: 23256-42-0) safe?

This compound is generally considered safe when handled properly. However, it should be used with ca...

Compound Q&A

How should 2-Hydroxypropanoic acid - 5-(3,4,5-trimethoxybenzyl)-2,4-pyrimidinediamine (CAS: 23256-42-0) be stored?

Store this compound in a cool, dry place, away from direct sunlight and heat sources. Keep it in a t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...