Compound Q&A

What is 4,4'-Diamino-2,2'-biphenyldisulfonic acid (CAS: 117-61-3)?

Answer

4,4'-Diamino-2,2'-biphenyldisulfonic acid
4,4'-Diamino-2,2'-biphenyldisulfonic acid is a chemical compound with the CAS number 117-61-3. It is a dianhydride with a molecular formula of C16H10N2O4S2. This compound possesses aromatic and sulfonic acid properties, making it useful in various applications.

About

CAS No 117-61-3
English Name 4,4'-Diamino-2,2'-biphenyldisulfonic acid
Molecular Formula C12H12N2O6S2
Molecular Weight 344.37 g/mol
SMILES C1=CC(=C(C=C1N)S(=O)(=O)O)C2=C(C=C(C=C2)N)S(=O)(=O)O
InChIKey MBJAPGAZEWPEFB-UHFFFAOYSA-N
Last Updated: 2025-09-03 20:19

Related Q&A

Compound Q&A

What are the main uses of 4,4'-Diamino-2,2'-biphenyldisulfonic acid (CAS: 117-61-3)?

4,4'-Diamino-2,2'-biphenyldisulfonic acid is primarily used in the synthesis of polyimides, which ar...

Compound Q&A

Is 4,4'-Diamino-2,2'-biphenyldisulfonic acid (CAS: 117-61-3) safe?

4,4'-Diamino-2,2'-biphenyldisulfonic acid is generally safe when handled properly. However, it may c...

Compound Q&A

How should 4,4'-Diamino-2,2'-biphenyldisulfonic acid (CAS: 117-61-3) be stored?

4,4'-Diamino-2,2'-biphenyldisulfonic acid should be stored in a tightly sealed container at room tem...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...