Compound Q&A

What is 3-[Dimethoxy(methyl)silyl]propyl methacrylate (CAS: 14513-34-9)?

Answer

3-[Dimethoxy(methyl)silyl]propyl methacrylate
3-[Dimethoxy(methyl)silyl]propyl methacrylate is a chemical compound used in various applications due to its reactive functional groups. Its chemical formula is C12H28O5Si. This compound is known for its stability and reactivity, making it useful in the manufacture of adhesives and coatings.

About

CAS No 14513-34-9
English Name 3-[Dimethoxy(methyl)silyl]propyl methacrylate
Molecular Formula C10H20O4Si
Molecular Weight 232.35 g/mol
SMILES CC(=C)C(=O)OCCC[Si](C)(OC)OC
InChIKey LZMNXXQIQIHFGC-UHFFFAOYSA-N
Last Updated: 2025-09-03 20:19

Related Q&A

Compound Q&A

What are the main uses of 3-[Dimethoxy(methyl)silyl]propyl methacrylate (CAS: 14513-34-9)?

3-[Dimethoxy(methyl)silyl]propyl methacrylate is primarily used in the production of adhesives and c...

Compound Q&A

Is 3-[Dimethoxy(methyl)silyl]propyl methacrylate (CAS: 14513-34-9) safe?

3-[Dimethoxy(methyl)silyl]propyl methacrylate is considered safe when handled properly. It is slight...

Compound Q&A

How should 3-[Dimethoxy(methyl)silyl]propyl methacrylate (CAS: 14513-34-9) be stored?

3-[Dimethoxy(methyl)silyl]propyl methacrylate should be stored in a cool, dry place away from direct...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...