Compound Q&A

What is 4-(4,6-Dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium chloride (CAS: 3945-69-5)?

Answer

4-(4,6-Dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium chloride
4-(4,6-Dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium chloride is a chemical compound with a unique structure that combines a triazole ring, a morpholine moiety, and chloride. It is characterized by its stability and specific functional groups.

About

CAS No 3945-69-5
English Name 4-(4,6-Dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium chloride
Molecular Formula C10H17ClN4O3
Molecular Weight 276.72 g/mol
SMILES C[N+]1(CCOCC1)C2=NC(=NC(=N2)OC)OC.[Cl-]
InChIKey BMTZEAOGFDXDAD-UHFFFAOYSA-M
Last Updated: 2025-09-03 20:19

Related Q&A

Compound Q&A

What are the main uses of 4-(4,6-Dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium chloride (CAS: 3945-69-5)?

This compound is primarily used in pharmaceuticals for its antimicrobial properties, making it a val...

Compound Q&A

Is 4-(4,6-Dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium chloride (CAS: 3945-69-5) safe?

The compound is generally considered safe, but it should be handled with care. It is non-toxic, but ...

Compound Q&A

How should 4-(4,6-Dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium chloride (CAS: 3945-69-5) be stored?

Store the compound in a cool, dry place away from direct sunlight. Keep it in a tightly sealed conta...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...