Compound Q&A

What is 2-[(3-Chloro-2-methylphenyl)amino]benzoic acid (CAS: 13710-19-5)?

Answer

2-[(3-Chloro-2-methylphenyl)amino]benzoic acid
2-[(3-Chloro-2-methylphenyl)amino]benzoic acid (CAS: 13710-19-5) is an aromatic carboxylic acid with a molecular formula of C14H11ClNO2. It is characterized by its unique structure, which includes a phenyl ring, a chloro-substituted benzene ring, and a carboxylic acid group. This compound is commonly used in pharmaceuticals and is a key intermediate in the synthesis of various organic compounds.

About

CAS No 13710-19-5
English Name 2-[(3-Chloro-2-methylphenyl)amino]benzoic acid
Molecular Formula C14H12ClNO2
Molecular Weight 261.71 g/mol
SMILES CC1=C(C=CC=C1Cl)NC2=CC=CC=C2C(=O)O
InChIKey YEZNLOUZAIOMLT-UHFFFAOYSA-N
Last Updated: 2025-09-03 20:19

Related Q&A

Compound Q&A

What are the main uses of 2-[(3-Chloro-2-methylphenyl)amino]benzoic acid (CAS: 13710-19-5)?

2-[(3-Chloro-2-methylphenyl)amino]benzoic acid (CAS: 13710-19-5) is primarily used in the pharmaceut...

Compound Q&A

Is 2-[(3-Chloro-2-methylphenyl)amino]benzoic acid (CAS: 13710-19-5) safe?

2-[(3-Chloro-2-methylphenyl)amino]benzoic acid (CAS: 13710-19-5) is generally considered safe for in...

Compound Q&A

How should 2-[(3-Chloro-2-methylphenyl)amino]benzoic acid (CAS: 13710-19-5) be stored?

2-[(3-Chloro-2-methylphenyl)amino]benzoic acid (CAS: 13710-19-5) should be stored in a cool, dry pla...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...