Compound Q&A

What are the main uses of 2-(3-Chlorophenoxy)propanoic acid (CAS: 101-10-0)?

Answer

2-(3-Chlorophenoxy)propanoic acid
2-(3-Chlorophenoxy)propanoic acid is primarily used as a research tool in the pharmaceutical industry for the synthesis of other compounds. It is also used as a herbicide to inhibit plant growth. Its chemical properties make it valuable in various scientific applications.

About

CAS No 101-10-0
English Name 2-(3-Chlorophenoxy)propanoic acid
Molecular Formula C9H9ClO3
Molecular Weight 200.62 g/mol
SMILES CC(C(=O)O)OC1=CC(=CC=C1)Cl
InChIKey YNTJKQDWYXUTLZ-UHFFFAOYSA-N
Last Updated: 2025-09-03 20:19

Related Q&A

Compound Q&A

What is 2-(3-Chlorophenoxy)propanoic acid (CAS: 101-10-0)?

2-(3-Chlorophenoxy)propanoic acid (CAS: 101-10-0) is an organic compound with the chemical formula C...

Compound Q&A

Is 2-(3-Chlorophenoxy)propanoic acid (CAS: 101-10-0) safe?

2-(3-Chlorophenoxy)propanoic acid, like many chemicals, requires proper handling and storage to ensu...

Compound Q&A

How should 2-(3-Chlorophenoxy)propanoic acid (CAS: 101-10-0) be stored?

2-(3-Chlorophenoxy)propanoic acid should be stored in a cool, dry place away from direct sunlight an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...