Compound Q&A

What is 3,4-Dihydroxy-5-nitrobenzaldehyde (CAS: 116313-85-0)?

Answer

3,4-Dihydroxy-5-nitrobenzaldehyde
3,4-Dihydroxy-5-nitrobenzaldehyde is a chemical compound with the chemical formula C9H6NO4. It is a white crystalline solid with a characteristic odor. It is used in the synthesis of various organic compounds and has potential applications in the pharmaceutical and research fields.

About

English Name 3,4-Dihydroxy-5-nitrobenzaldehyde
Molecular Formula C7H5NO5
Molecular Weight 183.12 g/mol
SMILES C1=C(C=C(C(=C1[N+](=O)[O-])O)O)C=O
InChIKey BBFJODMCHICIAA-UHFFFAOYSA-N
Last Updated: 2025-09-03 20:19

Related Q&A

Compound Q&A

What are the main uses of 3,4-Dihydroxy-5-nitrobenzaldehyde (CAS: 116313-85-0)?

3,4-Dihydroxy-5-nitrobenzaldehyde is primarily used in the synthesis of other organic compounds, inc...

Compound Q&A

Is 3,4-Dihydroxy-5-nitrobenzaldehyde (CAS: 116313-85-0) safe?

3,4-Dihydroxy-5-nitrobenzaldehyde is generally considered safe for industrial use when handled with ...

Compound Q&A

How should 3,4-Dihydroxy-5-nitrobenzaldehyde (CAS: 116313-85-0) be stored?

3,4-Dihydroxy-5-nitrobenzaldehyde should be stored in a tightly sealed container in a cool, dry plac...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...