Compound Q&A

What is Tris(2,4-pentanedionato)ruthenium(III) (CAS: 14284-93-6)?

Answer

Tris(2,4-pentanedionato)ruthenium(III)
Tris(2,4-pentanedionato)ruthenium(III) is a complex compound of ruthenium with three 2,4-pentanedionato ligands. It has the chemical formula [Ru(C5H4O2)3]. This compound is known for its stability and is used in various applications due to its unique electronic and optical properties.

About

CAS No 14284-93-6
English Name Tris(2,4-pentanedionato)ruthenium(III)
Molecular Formula C15H21O6Ru
Molecular Weight 398.39 g/mol
EINECS 238-193-0
SMILES CC1=[O][Ru+3]23([O]=C([CH-]1)C)([O]=C(C)[CH-]C(=[O]2)C)[O]=C(C)[CH-]C(=[O]3)C
InChIKey RTZYCRSRNSTRGC-LNTINUHCSA-K
Last Updated: 2025-09-03 20:19

Related Q&A

Compound Q&A

What are the main uses of Tris(2,4-pentanedionato)ruthenium(III) (CAS: 14284-93-6)?

Tris(2,4-pentanedionato)ruthenium(III) is primarily used in organic electronics, such as organic lig...

Compound Q&A

Is Tris(2,4-pentanedionato)ruthenium(III) (CAS: 14284-93-6) safe?

Tris(2,4-pentanedionato)ruthenium(III) is generally considered safe for laboratory use when handled ...

Compound Q&A

How should Tris(2,4-pentanedionato)ruthenium(III) (CAS: 14284-93-6) be stored?

Tris(2,4-pentanedionato)ruthenium(III) should be stored in a cool, dry place to maintain its stabili...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...