Compound Q&A

What is 2-Amino-3-bromobenzoic acid (CAS: 20776-51-6)?

Answer

2-Amino-3-bromobenzoic acid
2-Amino-3-bromobenzoic acid is a chemical compound with the CAS number 20776-51-6. It has the chemical formula C8H7BrNO2 and is a white or light yellow crystalline solid. It is used primarily in the pharmaceutical and chemical industries due to its functional groups, which make it suitable for various synthetic reactions.

About

CAS No 20776-51-6
English Name 2-Amino-3-bromobenzoic acid
Molecular Formula C7H6BrNO2
Molecular Weight 216.03 g/mol
SMILES C1=CC(=C(C(=C1)Br)N)C(=O)O
InChIKey SRIZNTFPBWRGPB-UHFFFAOYSA-N
Last Updated: 2025-09-03 20:18

Related Q&A

Compound Q&A

What are the main uses of 2-Amino-3-bromobenzoic acid (CAS: 20776-51-6)?

2-Amino-3-bromobenzoic acid is mainly used in the pharmaceutical industry as a precursor for the syn...

Compound Q&A

Is 2-Amino-3-bromobenzoic acid (CAS: 20776-51-6) safe?

2-Amino-3-bromobenzoic acid is generally safe when handled properly. It is classified as a hazardous...

Compound Q&A

How should 2-Amino-3-bromobenzoic acid (CAS: 20776-51-6) be stored?

2-Amino-3-bromobenzoic acid should be stored in a cool, dry place, ideally at room temperature (15-2...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...