Compound Q&A

What is 2-Hydroxy-5-octanoylbenzoic acid (CAS: 78418-01-6)?

Answer

2-Hydroxy-5-octanoylbenzoic acid
2-Hydroxy-5-octanoylbenzoic acid is a derivative of benzoic acid with a hydroxy group and an octanoyl substituent. It has the chemical formula C15H26O4. This compound exhibits acidic properties and is used in various applications due to its unique chemical structure.

About

CAS No 78418-01-6
English Name 2-Hydroxy-5-octanoylbenzoic acid
Molecular Formula C15H20O4
Molecular Weight 264.32 g/mol
SMILES CCCCCCCC(=O)C1=CC(=C(C=C1)O)C(=O)O
InChIKey IXIGWKNBFPKCCD-UHFFFAOYSA-N
Last Updated: 2025-09-03 20:18

Related Q&A

Compound Q&A

What are the main uses of 2-Hydroxy-5-octanoylbenzoic acid (CAS: 78418-01-6)?

2-Hydroxy-5-octanoylbenzoic acid is used in the pharmaceutical industry for the production of certai...

Compound Q&A

Is 2-Hydroxy-5-octanoylbenzoic acid (CAS: 78418-01-6) safe?

2-Hydroxy-5-octanoylbenzoic acid is generally considered safe for its intended uses. However, it is ...

Compound Q&A

How should 2-Hydroxy-5-octanoylbenzoic acid (CAS: 78418-01-6) be stored?

2-Hydroxy-5-octanoylbenzoic acid should be stored in a cool, dry place away from direct sunlight and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...