Compound Q&A

What is (3S,4R,4aS,6aS,6bR,8aR,12aR,12bS,14aS,14bS)-4,4a,6b,8a,11,11,12b,14a-Octamethyldocosahydro-3-picenol (CAS: 16844-71-6)?

Answer

(3S,4R,4aS,6aS,6bR,8aR,12aR,12bS,14aS,14bS)-4,4a,6b,8a,11,11,12b,14a-Octamethyldocosahydro-3-picenol
This compound is a complex cyclic alcohol with a specific stereochemistry. It contains multiple chiral centers, making it a chiral molecule. Its structure includes a icosahydro-3-penol framework with additional methyl groups attached, giving it unique physical and chemical properties.

About

CAS No 16844-71-6
English Name (3S,4R,4aS,6aS,6bR,8aR,12aR,12bS,14aS,14bS)-4,4a,6b,8a,11,11,12b,14a-Octamethyldocosahydro-3-picenol
Molecular Formula C30H52O
Molecular Weight 428.75 g/mol
SMILES CC1C(CCC2C1(CCC3C2(CCC4(C3(CCC5(C4CC(CC5)(C)C)C)C)C)C)C)O
InChIKey XCDQFROEGGNAER-PFOIMGGJSA-N
Last Updated: 2025-09-03 20:18

Related Q&A

Compound Q&A

What are the main uses of (3S,4R,4aS,6aS,6bR,8aR,12aR,12bS,14aS,14bS)-4,4a,6b,8a,11,11,12b,14a-Octamethyldocosahydro-3-picenol (CAS: 16844-71-6)?

This compound is primarily used in research due to its unique structure. It can serve as a model com...

Compound Q&A

Is (3S,4R,4aS,6aS,6bR,8aR,12aR,12bS,14aS,14bS)-4,4a,6b,8a,11,11,12b,14a-Octamethyldocosahydro-3-picenol (CAS: 16844-71-6) safe?

This compound is generally considered safe under laboratory conditions with proper handling. It is i...

Compound Q&A

How should (3S,4R,4aS,6aS,6bR,8aR,12aR,12bS,14aS,14bS)-4,4a,6b,8a,11,11,12b,14a-Octamethyldocosahydro-3-picenol (CAS: 16844-71-6) be stored?

Store this compound in a cool, dry place, away from direct sunlight and heat sources. It should be k...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...