Compound Q&A

What is 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)bis(2-methylphenol) (CAS: 1733-12-6)?

Answer

4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)bis(2-methylphenol)
4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)bis(2-methylphenol) is a chemical compound with the CAS number 1733-12-6. It is a type of bisphenol derivative with a unique benzoxathiole structure, making it useful in various applications.

About

CAS No 1733-12-6
English Name 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)bis(2-methylphenol)
Molecular Formula C21H18O5S
Molecular Weight 382.44 g/mol
SMILES CC1=C(C=CC(=C1)C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C=C4)O)C)O
InChIKey OBRMNDMBJQTZHV-UHFFFAOYSA-N
Last Updated: 2025-09-02 18:52

Related Q&A

Compound Q&A

What are the main uses of 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)bis(2-methylphenol) (CAS: 1733-12-6)?

This compound is primarily used in the pharmaceutical industry for its synthesis in drug development...

Compound Q&A

Is 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)bis(2-methylphenol) (CAS: 1733-12-6) safe?

The compound is generally considered safe under normal handling conditions. However, it is important...

Compound Q&A

How should 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)bis(2-methylphenol) (CAS: 1733-12-6) be stored?

Store the compound in a cool, dry place away from direct sunlight and heat sources. Keep it in a tig...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...