Compound Q&A

What is (5R)-3-(4-Bromo-3-fluorophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one (CAS: 444335-16-4)?

Answer

(5R)-3-(4-Bromo-3-fluorophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one
It is a chiral organobromine compound with a complex structure, belonging to the class of oxazolidinones. It has a chemical formula of C12H10BrFNO3. This compound is characterized by its unique electronic and structural properties, which make it suitable for specific chemical and pharmaceutical applications.

About

English Name (5R)-3-(4-Bromo-3-fluorophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one
Molecular Formula C10H9BrFNO3
Molecular Weight 290.09 g/mol
SMILES C1C(OC(=O)N1C2=CC(=C(C=C2)Br)F)CO
InChIKey UGBKYDASQNOIHP-SSDOTTSWSA-N
Last Updated: 2025-09-02 18:52

Related Q&A

Compound Q&A

What are the main uses of (5R)-3-(4-Bromo-3-fluorophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one (CAS: 444335-16-4)?

Primarily used in the synthesis of pharmaceuticals and as a reagent in organic chemistry due to its ...

Compound Q&A

Is (5R)-3-(4-Bromo-3-fluorophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one (CAS: 444335-16-4) safe?

It is generally stable but requires appropriate handling. Toxicity data is limited, and it should be...

Compound Q&A

How should (5R)-3-(4-Bromo-3-fluorophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one (CAS: 444335-16-4) be stored?

Store in a cool, dry place away from light and heat sources. Keep in a sealed container to prevent m...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...