Compound Q&A

What is Benzaldehyde, 5-(2-bromoacetyl)-2-hydroxy- (CAS: 115787-50-3)?

Answer

Benzaldehyde, 5-(2-bromoacetyl)-2-hydroxy-
Benzaldehyde, 5-(2-bromoacetyl)-2-hydroxy- (CAS 115787-50-3) is a chemical compound with a molecular structure that includes a benzaldehyde group, a 2-hydroxy group, and a 2-bromoacetyl substituent. It is a colorless to yellow liquid with a characteristic almond-like odor.

About

English Name Benzaldehyde, 5-(2-bromoacetyl)-2-hydroxy-
Molecular Formula C9H7BrO3
Molecular Weight 243.05 g/mol
SMILES C1=CC(=C(C=C1C(=O)CBr)C=O)O
InChIKey LPSGRBXPXIPMPF-UHFFFAOYSA-N
Last Updated: 2025-09-02 18:52

Related Q&A

Compound Q&A

What are the main uses of Benzaldehyde, 5-(2-bromoacetyl)-2-hydroxy- (CAS: 115787-50-3)?

This compound is primarily used in the synthesis of various organic compounds and as a reagent in or...

Compound Q&A

Is Benzaldehyde, 5-(2-bromoacetyl)-2-hydroxy- (CAS: 115787-50-3) safe?

Benzaldehyde, 5-(2-bromoacetyl)-2-hydroxy- is generally safe when handled with appropriate precautio...

Compound Q&A

How should Benzaldehyde, 5-(2-bromoacetyl)-2-hydroxy- (CAS: 115787-50-3) be stored?

Store in a cool, dry place away from direct sunlight and heat sources. Maintain the container tightl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...